About 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine
6-ethyl-3-methylsulfonyl-3,4-dihydropyridine (PubChem CID 163689115) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine |
| PubChem CID | 163689115 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine |
| SMILES | CCC1=CCC(S(C)(=O)=O)C=N1 |
| InChI | InChI=1S/C8H13NO2S/c1-3-7-4-5-8(6-9-7)12(2,10)11/h4,6,8H,3,5H2,1-2H3 |
| InChIKey | JRKSQZKRGVBBLI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine?
The IUPAC name of 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine (CID 163689115) is 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine.
What is the SMILES notation for 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine?
The canonical SMILES for 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine is CCC1=CCC(S(C)(=O)=O)C=N1.
What is the InChIKey of 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine?
The InChIKey is JRKSQZKRGVBBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-3-7-4-5-8(6-9-7)12(2,10)11/h4,6,8H,3,5H2,1-2H3.
What are the key properties of 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine?
6-ethyl-3-methylsulfonyl-3,4-dihydropyridine has a molecular weight of 187.26 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-methylsulfonyl-3,4-dihydropyridine is sourced from PubChem (CID 163689115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).