C7H11NS — CID 143707893
6-methyl-3-methylsulfanyl-3,4-dihydropyridine (PubChem CID 143707893) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 6-methyl-3-methylsulfanyl-3,4-dihydropyridine.
| Compound Name | 6-methyl-3-methylsulfanyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 143707893 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 6-methyl-3-methylsulfanyl-3,4-dihydropyridine |
| SMILES | CSC1C=NC(C)=CC1 |
| InChI | InChI=1S/C7H11NS/c1-6-3-4-7(9-2)5-8-6/h3,5,7H,4H2,1-2H3 |
| InChIKey | FWNITMNLGWRESQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |