About 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine
6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine (PubChem CID 59897658) has the molecular formula C8H13NS2
and a molecular weight of 187.33 g/mol. Its IUPAC name is 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine.
Analyze 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine?
The IUPAC name of 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine (CID 59897658) is 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine.
What is the SMILES notation for 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine?
The canonical SMILES for 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine is CSC1=NC(C)=CC(SC)C1.
What is the InChIKey of 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine?
The InChIKey is TWLFQZNBXHDGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS2/c1-6-4-7(10-2)5-8(9-6)11-3/h4,7H,5H2,1-3H3.
What are the key properties of 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine?
6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine has a molecular weight of 187.33 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,4-bis(methylsulfanyl)-3,4-dihydropyridine is sourced from PubChem (CID 59897658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).