C16H17IO — CID 163691105
(8-ethyldibenzofuran-3-yl)-dimethyl-λ3-iodane (PubChem CID 163691105) has the molecular formula C16H17IO and a molecular weight of 352.22 g/mol. Its IUPAC name is (8-ethyldibenzofuran-3-yl)-dimethyl-λ3-iodane.
| Compound Name | (8-ethyldibenzofuran-3-yl)-dimethyl-λ3-iodane |
|---|---|
| PubChem CID | 163691105 |
| Molecular Formula | C16H17IO |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (8-ethyldibenzofuran-3-yl)-dimethyl-λ3-iodane |
| SMILES | CCc1ccc2oc3cc(I(C)C)ccc3c2c1 |
| InChI | InChI=1S/C16H17IO/c1-4-11-5-8-15-14(9-11)13-7-6-12(17(2)3)10-16(13)18-15/h5-10H,4H2,1-3H3 |
| InChIKey | JTAFRSULAJDYAQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|