C26H34IN7O2 — CID 163691206
4-[(9-cyclopentyl-7,7-dimethyl-13λ3-ioda-2,4,5,9,11-pentazatricyclo[8.6.0.02,6]hexadeca-1(16),3,5,10,12-pentaen-12-yl)amino]-3-methoxy-N-methylbenzamide (PubChem CID 163691206) has the molecular formula C26H34IN7O2 and a molecular weight of 603.51 g/mol. Its IUPAC name is 4-[(9-cyclopentyl-7,7-dimethyl-13λ3-ioda-2,4,5,9,11-pentazatricyclo[8.6.0.02,6]hexadeca-1(16),3,5,10,12-pentaen-12-yl)amino]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-[(9-cyclopentyl-7,7-dimethyl-13λ3-ioda-2,4,5,9,11-pentazatricyclo[8.6.0.02,6]hexadeca-1(16),3,5,10,12-pentaen-12-yl)amino]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 163691206 |
| Molecular Formula | C26H34IN7O2 |
| Molecular Weight | 603.51 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | 4-[(9-cyclopentyl-7,7-dimethyl-13λ3-ioda-2,4,5,9,11-pentazatricyclo[8.6.0.02,6]hexadeca-1(16),3,5,10,12-pentaen-12-yl)amino]-3-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N/C2=I/CCC=C3C(=N2)N(C2CCCC2)CC(C)(C)c2nncn23)c(OC)c1 |
| InChI | InChI=1S/C26H34IN7O2/c1-26(2)15-33(18-8-5-6-9-18)22-20(34-16-29-32-24(26)34)10-7-13-27-25(31-22)30-19-12-11-17(23(35)28-3)14-21(19)36-4/h10-12,14,16,18,30H,5-9,13,15H2,1-4H3,(H,28,35) |
| InChIKey | JTCGOCMVSWERJS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|