C22H29NOS — CID 163692558
1-[6-(dimethylamino)naphthalen-2-yl]-3-[(2R)-2-methylhex-5-enyl]sulfanylpropan-1-one (PubChem CID 163692558) has the molecular formula C22H29NOS and a molecular weight of 355.55 g/mol. Its IUPAC name is 1-[6-(dimethylamino)naphthalen-2-yl]-3-[(2R)-2-methylhex-5-enyl]sulfanylpropan-1-one.
| Compound Name | 1-[6-(dimethylamino)naphthalen-2-yl]-3-[(2R)-2-methylhex-5-enyl]sulfanylpropan-1-one |
|---|---|
| PubChem CID | 163692558 |
| Molecular Formula | C22H29NOS |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-[6-(dimethylamino)naphthalen-2-yl]-3-[(2R)-2-methylhex-5-enyl]sulfanylpropan-1-one |
| SMILES | C=CCC[C@@H](C)CSCCC(=O)c1ccc2cc(N(C)C)ccc2c1 |
| InChI | InChI=1S/C22H29NOS/c1-5-6-7-17(2)16-25-13-12-22(24)20-9-8-19-15-21(23(3)4)11-10-18(19)14-20/h5,8-11,14-15,17H,1,6-7,12-13,16H2,2-4H3/t17-/m1/s1 |
| InChIKey | JUERVYXNDXMSLB-QGZVFWFLSA-N |
| XLogP | 5.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|