C13H18ClNO3S — CID 163693213
(2S)-2-[(4-chlorophenyl)-hydroxy-methyl-oxo-λ6-sulfanyl]oxy-4-methylpentanenitrile (PubChem CID 163693213) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)-hydroxy-methyl-oxo-λ6-sulfanyl]oxy-4-methylpentanenitrile.
| Compound Name | (2S)-2-[(4-chlorophenyl)-hydroxy-methyl-oxo-λ6-sulfanyl]oxy-4-methylpentanenitrile |
|---|---|
| PubChem CID | 163693213 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)-hydroxy-methyl-oxo-λ6-sulfanyl]oxy-4-methylpentanenitrile |
| SMILES | CC(C)C[C@@H](C#N)OS(C)(=O)(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-10(2)8-12(9-15)18-19(3,16,17)13-6-4-11(14)5-7-13/h4-7,10,12H,8H2,1-3H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | JUTCHDAQSQQZBL-LBPRGKRZSA-N |
| XLogP | 3.49 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |