C25H36O7 — CID 163697171
[4-[(3Z)-3-ethylideneoxan-2-yl]oxy-5-methylcyclohexa-1,3-dien-1-yl] 6-(2-prop-2-enoyloxyethoxy)hexanoate (PubChem CID 163697171) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is [4-[(3Z)-3-ethylideneoxan-2-yl]oxy-5-methylcyclohexa-1,3-dien-1-yl] 6-(2-prop-2-enoyloxyethoxy)hexanoate.
| Compound Name | [4-[(3Z)-3-ethylideneoxan-2-yl]oxy-5-methylcyclohexa-1,3-dien-1-yl] 6-(2-prop-2-enoyloxyethoxy)hexanoate |
|---|---|
| PubChem CID | 163697171 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [4-[(3Z)-3-ethylideneoxan-2-yl]oxy-5-methylcyclohexa-1,3-dien-1-yl] 6-(2-prop-2-enoyloxyethoxy)hexanoate |
| SMILES | C=CC(=O)OCCOCCCCCC(=O)OC1=CC=C(OC2OCCC/C2=C/C)C(C)C1 |
| InChI | InChI=1S/C25H36O7/c1-4-20-10-9-15-30-25(20)32-22-13-12-21(18-19(22)3)31-24(27)11-7-6-8-14-28-16-17-29-23(26)5-2/h4-5,12-13,19,25H,2,6-11,14-18H2,1,3H3/b20-4- |
| InChIKey | JXXBNQKBLSAHNT-YQLNASGTSA-N |
| XLogP | 4.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|