C10H7F3N2O — CID 163697697
2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-oxadiazole (PubChem CID 163697697) has the molecular formula C10H7F3N2O and a molecular weight of 228.17 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 163697697 |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1ccc(Cc2nnco2)cc1 |
| InChI | InChI=1S/C10H7F3N2O/c11-10(12,13)8-3-1-7(2-4-8)5-9-15-14-6-16-9/h1-4,6H,5H2 |
| InChIKey | JYHUTQHRHVKPPM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |