C31H30IN3O2 — CID 163697752
6-methyl-2-(oxan-4-yloxy)-4-(tritylamino)pyridine-3-carboximidoyl iodide (PubChem CID 163697752) has the molecular formula C31H30IN3O2 and a molecular weight of 603.50 g/mol. Its IUPAC name is 6-methyl-2-(oxan-4-yloxy)-4-(tritylamino)pyridine-3-carboximidoyl iodide.
| Compound Name | 6-methyl-2-(oxan-4-yloxy)-4-(tritylamino)pyridine-3-carboximidoyl iodide |
|---|---|
| PubChem CID | 163697752 |
| Molecular Formula | C31H30IN3O2 |
| Molecular Weight | 603.50 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 6-methyl-2-(oxan-4-yloxy)-4-(tritylamino)pyridine-3-carboximidoyl iodide |
| SMILES | [H]/N=C(\I)c1c(NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc(C)nc1OC1CCOCC1 |
| InChI | InChI=1S/C31H30IN3O2/c1-22-21-27(28(29(32)33)30(34-22)37-26-17-19-36-20-18-26)35-31(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-16,21,26,33H,17-20H2,1H3,(H,34,35)/b33-29- |
| InChIKey | JYJADUJTBJPHKJ-IYOYZZHUSA-N |
| XLogP | 7.11 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.50 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|