C13H20N2O4 — CID 130269166
N-hydroxy-N,2,5-trimethyl-6-(oxan-4-yloxy)pyridin-3-amine oxide (PubChem CID 130269166) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-hydroxy-N,2,5-trimethyl-6-(oxan-4-yloxy)pyridin-3-amine oxide.
| Compound Name | N-hydroxy-N,2,5-trimethyl-6-(oxan-4-yloxy)pyridin-3-amine oxide |
|---|---|
| PubChem CID | 130269166 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-hydroxy-N,2,5-trimethyl-6-(oxan-4-yloxy)pyridin-3-amine oxide |
| SMILES | Cc1cc([N+](C)([O-])O)c(C)nc1OC1CCOCC1 |
| InChI | InChI=1S/C13H20N2O4/c1-9-8-12(15(3,16)17)10(2)14-13(9)19-11-4-6-18-7-5-11/h8,11,16H,4-7H2,1-3H3 |
| InChIKey | FBVZFZQYMCHVBR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|