C6H19N4O2PS — CID 163698100
methylamino-[2-(propylsulfonodiimidoyl)ethylamino]phosphinic acid (PubChem CID 163698100) has the molecular formula C6H19N4O2PS and a molecular weight of 242.28 g/mol. Its IUPAC name is methylamino-[2-(propylsulfonodiimidoyl)ethylamino]phosphinic acid.
| Compound Name | methylamino-[2-(propylsulfonodiimidoyl)ethylamino]phosphinic acid |
|---|---|
| PubChem CID | 163698100 |
| Molecular Formula | C6H19N4O2PS |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | methylamino-[2-(propylsulfonodiimidoyl)ethylamino]phosphinic acid |
| SMILES | [H]N=S(CCC)(CCNP(=O)(O)NC)=N[H] |
| InChI | InChI=1S/C6H19N4O2PS/c1-3-5-14(7,8)6-4-10-13(11,12)9-2/h7-8H,3-6H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | JYPRZMKOMBPVDQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|