C27H37ClN8O3S — CID 163698238
N-(2-chloro-6-methylphenyl)-2-[[6-[2-[[5-(hydroxyamino)-2,2,4,4-tetramethyl-5-oxopentyl]amino]ethylamino]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 163698238) has the molecular formula C27H37ClN8O3S and a molecular weight of 589.17 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[6-[2-[[5-(hydroxyamino)-2,2,4,4-tetramethyl-5-oxopentyl]amino]ethylamino]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[6-[2-[[5-(hydroxyamino)-2,2,4,4-tetramethyl-5-oxopentyl]amino]ethylamino]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 163698238 |
| Molecular Formula | C27H37ClN8O3S |
| Molecular Weight | 589.17 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[6-[2-[[5-(hydroxyamino)-2,2,4,4-tetramethyl-5-oxopentyl]amino]ethylamino]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NCCNCC(C)(C)CC(C)(C)C(=O)NO)cc(Nc2ncc(C(=O)Nc3c(C)cccc3Cl)s2)n1 |
| InChI | InChI=1S/C27H37ClN8O3S/c1-16-8-7-9-18(28)22(16)35-23(37)19-13-31-25(40-19)34-21-12-20(32-17(2)33-21)30-11-10-29-15-26(3,4)14-27(5,6)24(38)36-39/h7-9,12-13,29,39H,10-11,14-15H2,1-6H3,(H,35,37)(H,36,38)(H2,30,31,32,33,34) |
| InChIKey | JYSNHPGERYTTJP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.17 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|