C24H22FN5O4 — CID 163698421
2-[4-(4-fluorophenoxy)phenyl]-6-[(3-morpholin-4-yl-3-oxoprop-1-en-2-yl)amino]pyrimidine-4-carboxamide (PubChem CID 163698421) has the molecular formula C24H22FN5O4 and a molecular weight of 463.47 g/mol. Its IUPAC name is 2-[4-(4-fluorophenoxy)phenyl]-6-[(3-morpholin-4-yl-3-oxoprop-1-en-2-yl)amino]pyrimidine-4-carboxamide.
| Compound Name | 2-[4-(4-fluorophenoxy)phenyl]-6-[(3-morpholin-4-yl-3-oxoprop-1-en-2-yl)amino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 163698421 |
| Molecular Formula | C24H22FN5O4 |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[4-(4-fluorophenoxy)phenyl]-6-[(3-morpholin-4-yl-3-oxoprop-1-en-2-yl)amino]pyrimidine-4-carboxamide |
| SMILES | C=C(Nc1cc(C(N)=O)nc(-c2ccc(Oc3ccc(F)cc3)cc2)n1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H22FN5O4/c1-15(24(32)30-10-12-33-13-11-30)27-21-14-20(22(26)31)28-23(29-21)16-2-6-18(7-3-16)34-19-8-4-17(25)5-9-19/h2-9,14H,1,10-13H2,(H2,26,31)(H,27,28,29) |
| InChIKey | JYWQEJWRAJHEHW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|