C21H17FN4O3 — CID 89422459
2-[4-(4-fluorophenoxy)phenyl]-6-(6-oxa-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidine-4-carboxamide (PubChem CID 89422459) has the molecular formula C21H17FN4O3 and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-[4-(4-fluorophenoxy)phenyl]-6-(6-oxa-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 2-[4-(4-fluorophenoxy)phenyl]-6-(6-oxa-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 89422459 |
| Molecular Formula | C21H17FN4O3 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[4-(4-fluorophenoxy)phenyl]-6-(6-oxa-3-azabicyclo[3.1.0]hexan-3-yl)pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1cc(N2CC3OC3C2)nc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C21H17FN4O3/c22-13-3-7-15(8-4-13)28-14-5-1-12(2-6-14)21-24-16(20(23)27)9-19(25-21)26-10-17-18(11-26)29-17/h1-9,17-18H,10-11H2,(H2,23,27) |
| InChIKey | KJSYJYIWCWLJPT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|