C7H12INOS — CID 163705826
3-iodo-4-(2-methylpropyl)-1,3-oxazolidine-2-thione (PubChem CID 163705826) has the molecular formula C7H12INOS and a molecular weight of 285.15 g/mol. Its IUPAC name is 3-iodo-4-(2-methylpropyl)-1,3-oxazolidine-2-thione.
| Compound Name | 3-iodo-4-(2-methylpropyl)-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 163705826 |
| Molecular Formula | C7H12INOS |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 3-iodo-4-(2-methylpropyl)-1,3-oxazolidine-2-thione |
| SMILES | CC(C)CC1COC(=S)N1I |
| InChI | InChI=1S/C7H12INOS/c1-5(2)3-6-4-10-7(11)9(6)8/h5-6H,3-4H2,1-2H3 |
| InChIKey | KEZOBMXJTFPDDO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|