C19H30F3NO — CID 163706257
6-phenylmethoxy-N-propyl-N-(3,3,3-trifluoropropyl)hexan-1-amine (PubChem CID 163706257) has the molecular formula C19H30F3NO and a molecular weight of 345.45 g/mol. Its IUPAC name is 6-phenylmethoxy-N-propyl-N-(3,3,3-trifluoropropyl)hexan-1-amine.
| Compound Name | 6-phenylmethoxy-N-propyl-N-(3,3,3-trifluoropropyl)hexan-1-amine |
|---|---|
| PubChem CID | 163706257 |
| Molecular Formula | C19H30F3NO |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 6-phenylmethoxy-N-propyl-N-(3,3,3-trifluoropropyl)hexan-1-amine |
| SMILES | CCCN(CCCCCCOCc1ccccc1)CCC(F)(F)F |
| InChI | InChI=1S/C19H30F3NO/c1-2-13-23(15-12-19(20,21)22)14-8-3-4-9-16-24-17-18-10-6-5-7-11-18/h5-7,10-11H,2-4,8-9,12-17H2,1H3 |
| InChIKey | KFIFDVVWIRAJHW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|