C13H15F6NO — CID 87162454
2,2,2-trifluoro-N-(2-phenylmethoxyethyl)-N-(2,2,2-trifluoroethyl)ethanamine (PubChem CID 87162454) has the molecular formula C13H15F6NO and a molecular weight of 315.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-phenylmethoxyethyl)-N-(2,2,2-trifluoroethyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-N-(2-phenylmethoxyethyl)-N-(2,2,2-trifluoroethyl)ethanamine |
|---|---|
| PubChem CID | 87162454 |
| Molecular Formula | C13H15F6NO |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-phenylmethoxyethyl)-N-(2,2,2-trifluoroethyl)ethanamine |
| SMILES | FC(F)(F)CN(CCOCc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C13H15F6NO/c14-12(15,16)9-20(10-13(17,18)19)6-7-21-8-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | DEYGQBIASHPIMN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|