C18H22F4N2O3S — CID 163708721
1-[ethyl(2-sulfanylethyl)carbamoyl]-5-[2-fluoro-4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid (PubChem CID 163708721) has the molecular formula C18H22F4N2O3S and a molecular weight of 422.44 g/mol. Its IUPAC name is 1-[ethyl(2-sulfanylethyl)carbamoyl]-5-[2-fluoro-4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[ethyl(2-sulfanylethyl)carbamoyl]-5-[2-fluoro-4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 163708721 |
| Molecular Formula | C18H22F4N2O3S |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 1-[ethyl(2-sulfanylethyl)carbamoyl]-5-[2-fluoro-4-(trifluoromethyl)phenyl]piperidine-3-carboxylic acid |
| SMILES | CCN(CCS)C(=O)N1CC(C(=O)O)CC(c2ccc(C(F)(F)F)cc2F)C1 |
| InChI | InChI=1S/C18H22F4N2O3S/c1-2-23(5-6-28)17(27)24-9-11(7-12(10-24)16(25)26)14-4-3-13(8-15(14)19)18(20,21)22/h3-4,8,11-12,28H,2,5-7,9-10H2,1H3,(H,25,26) |
| InChIKey | KHIKWNSAJGRFLI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|