C13H13F4NO3 — CID 151058058
3-[1-[2-fluoro-4-(trifluoromethyl)phenoxy]ethyl]azetidine-1-carboxylic acid (PubChem CID 151058058) has the molecular formula C13H13F4NO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is 3-[1-[2-fluoro-4-(trifluoromethyl)phenoxy]ethyl]azetidine-1-carboxylic acid.
| Compound Name | 3-[1-[2-fluoro-4-(trifluoromethyl)phenoxy]ethyl]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 151058058 |
| Molecular Formula | C13H13F4NO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-[1-[2-fluoro-4-(trifluoromethyl)phenoxy]ethyl]azetidine-1-carboxylic acid |
| SMILES | CC(Oc1ccc(C(F)(F)F)cc1F)C1CN(C(=O)O)C1 |
| InChI | InChI=1S/C13H13F4NO3/c1-7(8-5-18(6-8)12(19)20)21-11-3-2-9(4-10(11)14)13(15,16)17/h2-4,7-8H,5-6H2,1H3,(H,19,20) |
| InChIKey | MFOMUNBJDYANHN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |