C13H13ClFN3O — CID 163708784
N'-[4-chloro-2-fluoro-5-[(2-methyl-3-pyridinyl)oxy]phenyl]methanediamine (PubChem CID 163708784) has the molecular formula C13H13ClFN3O and a molecular weight of 281.72 g/mol. Its IUPAC name is N'-[4-chloro-2-fluoro-5-[(2-methyl-3-pyridinyl)oxy]phenyl]methanediamine.
| Compound Name | N'-[4-chloro-2-fluoro-5-[(2-methyl-3-pyridinyl)oxy]phenyl]methanediamine |
|---|---|
| PubChem CID | 163708784 |
| Molecular Formula | C13H13ClFN3O |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N'-[4-chloro-2-fluoro-5-[(2-methyl-3-pyridinyl)oxy]phenyl]methanediamine |
| SMILES | Cc1ncccc1Oc1cc(NCN)c(F)cc1Cl |
| InChI | InChI=1S/C13H13ClFN3O/c1-8-12(3-2-4-17-8)19-13-6-11(18-7-16)10(15)5-9(13)14/h2-6,18H,7,16H2,1H3 |
| InChIKey | KHJQICHOXUTVAP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|