C19H24ClN3OS — CID 163709663
2-[8-[3-(5-chloro-2-methylsulfanylpyrimidin-4-yl)propyl]cycloocta-2,4,7-trien-1-yl]propanamide (PubChem CID 163709663) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is 2-[8-[3-(5-chloro-2-methylsulfanylpyrimidin-4-yl)propyl]cycloocta-2,4,7-trien-1-yl]propanamide.
| Compound Name | 2-[8-[3-(5-chloro-2-methylsulfanylpyrimidin-4-yl)propyl]cycloocta-2,4,7-trien-1-yl]propanamide |
|---|---|
| PubChem CID | 163709663 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[8-[3-(5-chloro-2-methylsulfanylpyrimidin-4-yl)propyl]cycloocta-2,4,7-trien-1-yl]propanamide |
| SMILES | CSc1ncc(Cl)c(CCCC2=CCC=CC=CC2C(C)C(N)=O)n1 |
| InChI | InChI=1S/C19H24ClN3OS/c1-13(18(21)24)15-10-6-4-3-5-8-14(15)9-7-11-17-16(20)12-22-19(23-17)25-2/h3-4,6,8,10,12-13,15H,5,7,9,11H2,1-2H3,(H2,21,24) |
| InChIKey | KICAATGZGSORBZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|