C7H16FN2O+ — CID 163714279
1-fluoro-N,N-dimethyl-1-morpholin-4-ium-4-ylmethanamine (PubChem CID 163714279) has the molecular formula C7H16FN2O+ and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-fluoro-N,N-dimethyl-1-morpholin-4-ium-4-ylmethanamine.
| Compound Name | 1-fluoro-N,N-dimethyl-1-morpholin-4-ium-4-ylmethanamine |
|---|---|
| PubChem CID | 163714279 |
| Molecular Formula | C7H16FN2O+ |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 1-fluoro-N,N-dimethyl-1-morpholin-4-ium-4-ylmethanamine |
| SMILES | CN(C)C(F)[NH+]1CCOCC1 |
| InChI | InChI=1S/C7H15FN2O/c1-9(2)7(8)10-3-5-11-6-4-10/h7H,3-6H2,1-2H3/p+1 |
| InChIKey | KLZDFNCUKXFXRK-UHFFFAOYSA-O |
| XLogP | -1.28 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|