C11H12BN3O2 — CID 163717339
ethyl 2-methyl-6-methylideneboranylpyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 163717339) has the molecular formula C11H12BN3O2 and a molecular weight of 229.05 g/mol. Its IUPAC name is ethyl 2-methyl-6-methylideneboranylpyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 2-methyl-6-methylideneboranylpyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 163717339 |
| Molecular Formula | C11H12BN3O2 |
| Molecular Weight | 229.05 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | ethyl 2-methyl-6-methylideneboranylpyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | C=Bc1cnc2c(C(=O)OCC)c(C)nn2c1 |
| InChI | InChI=1S/C11H12BN3O2/c1-4-17-11(16)9-7(2)14-15-6-8(12-3)5-13-10(9)15/h5-6H,3-4H2,1-2H3 |
| InChIKey | KOMYXIUXNXEEBI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.05 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|