C21H24FN7O2 — CID 163717514
1-[(2-fluoro-6-methylphenyl)methyl]-N-[(3R)-1,7,9-trimethyl-2-oxo-4,5-dihydro-3H-imidazo[1,5-a][1,3]diazepin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 163717514) has the molecular formula C21H24FN7O2 and a molecular weight of 425.47 g/mol. Its IUPAC name is 1-[(2-fluoro-6-methylphenyl)methyl]-N-[(3R)-1,7,9-trimethyl-2-oxo-4,5-dihydro-3H-imidazo[1,5-a][1,3]diazepin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(2-fluoro-6-methylphenyl)methyl]-N-[(3R)-1,7,9-trimethyl-2-oxo-4,5-dihydro-3H-imidazo[1,5-a][1,3]diazepin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 163717514 |
| Molecular Formula | C21H24FN7O2 |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-[(2-fluoro-6-methylphenyl)methyl]-N-[(3R)-1,7,9-trimethyl-2-oxo-4,5-dihydro-3H-imidazo[1,5-a][1,3]diazepin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cccc(F)c1Cn1cnc(C(=O)N[C@@H]2CCn3c(C)nc(C)c3N(C)C2=O)n1 |
| InChI | InChI=1S/C21H24FN7O2/c1-12-6-5-7-16(22)15(12)10-28-11-23-18(26-28)19(30)25-17-8-9-29-14(3)24-13(2)20(29)27(4)21(17)31/h5-7,11,17H,8-10H2,1-4H3,(H,25,30)/t17-/m1/s1 |
| InChIKey | KOQVDLAORTUOPQ-QGZVFWFLSA-N |
| XLogP | 1.75 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |