C22H23FN6O3 — CID 139368071
N-[(3R)-7-ethyl-1-methyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-1-[(2-fluorophenyl)methyl]-1,2,4-triazole-3-carboxamide (PubChem CID 139368071) has the molecular formula C22H23FN6O3 and a molecular weight of 438.46 g/mol. Its IUPAC name is N-[(3R)-7-ethyl-1-methyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-1-[(2-fluorophenyl)methyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(3R)-7-ethyl-1-methyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-1-[(2-fluorophenyl)methyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 139368071 |
| Molecular Formula | C22H23FN6O3 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[(3R)-7-ethyl-1-methyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-1-[(2-fluorophenyl)methyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCn1cc2c(cc1=O)N(C)C(=O)[C@H](NC(=O)c1ncn(Cc3ccccc3F)n1)CC2 |
| InChI | InChI=1S/C22H23FN6O3/c1-3-28-11-15-8-9-17(22(32)27(2)18(15)10-19(28)30)25-21(31)20-24-13-29(26-20)12-14-6-4-5-7-16(14)23/h4-7,10-11,13,17H,3,8-9,12H2,1-2H3,(H,25,31)/t17-/m1/s1 |
| InChIKey | YOIYAFDZPJGKSA-QGZVFWFLSA-N |
| XLogP | 1.35 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |