C25H25FN6O3S — CID 168952080
1-benzyl-N-[(3R)-8-(3,3-dimethyl-2-oxoazetidin-1-yl)-7-fluoro-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 168952080) has the molecular formula C25H25FN6O3S and a molecular weight of 508.58 g/mol. Its IUPAC name is 1-benzyl-N-[(3R)-8-(3,3-dimethyl-2-oxoazetidin-1-yl)-7-fluoro-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(3R)-8-(3,3-dimethyl-2-oxoazetidin-1-yl)-7-fluoro-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 168952080 |
| Molecular Formula | C25H25FN6O3S |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 1-benzyl-N-[(3R)-8-(3,3-dimethyl-2-oxoazetidin-1-yl)-7-fluoro-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2ncn(Cc3ccccc3)n2)CSc2cc(N3CC(C)(C)C3=O)c(F)cc21 |
| InChI | InChI=1S/C25H25FN6O3S/c1-25(2)13-32(24(25)35)18-10-20-19(9-16(18)26)30(3)23(34)17(12-36-20)28-22(33)21-27-14-31(29-21)11-15-7-5-4-6-8-15/h4-10,14,17H,11-13H2,1-3H3,(H,28,33)/t17-/m0/s1 |
| InChIKey | LNHXWJBWNXEJRD-KRWDZBQOSA-N |
| XLogP | 2.71 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |