C16H18O5 — CID 163718066
(7S)-7-hydroxy-6-oxo-2-(2-oxocyclopropyl)-7-phenylheptanoic acid (PubChem CID 163718066) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is (7S)-7-hydroxy-6-oxo-2-(2-oxocyclopropyl)-7-phenylheptanoic acid.
| Compound Name | (7S)-7-hydroxy-6-oxo-2-(2-oxocyclopropyl)-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 163718066 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (7S)-7-hydroxy-6-oxo-2-(2-oxocyclopropyl)-7-phenylheptanoic acid |
| SMILES | O=C(O)C(CCCC(=O)[C@@H](O)c1ccccc1)C1CC1=O |
| InChI | InChI=1S/C16H18O5/c17-13(15(19)10-5-2-1-3-6-10)8-4-7-11(16(20)21)12-9-14(12)18/h1-3,5-6,11-12,15,19H,4,7-9H2,(H,20,21)/t11?,12?,15-/m0/s1 |
| InChIKey | KPCCOQMSRFPMME-QOZQQMKHSA-N |
| XLogP | 1.75 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |