C16H21N3O3 — CID 163718152
2-amino-N-[2-(6-formyl-1,2,7,8-tetrahydrofuro[3,2-e]indol-8-yl)ethyl]propanamide (PubChem CID 163718152) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-amino-N-[2-(6-formyl-1,2,7,8-tetrahydrofuro[3,2-e]indol-8-yl)ethyl]propanamide.
| Compound Name | 2-amino-N-[2-(6-formyl-1,2,7,8-tetrahydrofuro[3,2-e]indol-8-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 163718152 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-amino-N-[2-(6-formyl-1,2,7,8-tetrahydrofuro[3,2-e]indol-8-yl)ethyl]propanamide |
| SMILES | CC(N)C(=O)NCCC1CN(C=O)c2ccc3c(c21)CCO3 |
| InChI | InChI=1S/C16H21N3O3/c1-10(17)16(21)18-6-4-11-8-19(9-20)13-2-3-14-12(15(11)13)5-7-22-14/h2-3,9-11H,4-8,17H2,1H3,(H,18,21) |
| InChIKey | KPDWHGQOAJABOG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|