C13H17BrNO2+ — CID 163719185
[2-bromo-3-[4-(2-hydroxyethoxy)phenyl]buta-1,3-dienyl]-methylazanium (PubChem CID 163719185) has the molecular formula C13H17BrNO2+ and a molecular weight of 299.19 g/mol. Its IUPAC name is [2-bromo-3-[4-(2-hydroxyethoxy)phenyl]buta-1,3-dienyl]-methylazanium.
| Compound Name | [2-bromo-3-[4-(2-hydroxyethoxy)phenyl]buta-1,3-dienyl]-methylazanium |
|---|---|
| PubChem CID | 163719185 |
| Molecular Formula | C13H17BrNO2+ |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | [2-bromo-3-[4-(2-hydroxyethoxy)phenyl]buta-1,3-dienyl]-methylazanium |
| SMILES | C=C(C(Br)=C[NH2+]C)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C13H16BrNO2/c1-10(13(14)9-15-2)11-3-5-12(6-4-11)17-8-7-16/h3-6,9,15-16H,1,7-8H2,2H3/p+1 |
| InChIKey | KQAKZISZSFHWIX-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|