C19H23INO3+ — CID 163720504
[2-[(1S,2S)-2-(benzylcarbamoyloxy)-1-methoxybutyl]phenyl]iodanium (PubChem CID 163720504) has the molecular formula C19H23INO3+ and a molecular weight of 440.30 g/mol. Its IUPAC name is [2-[(1S,2S)-2-(benzylcarbamoyloxy)-1-methoxybutyl]phenyl]iodanium.
| Compound Name | [2-[(1S,2S)-2-(benzylcarbamoyloxy)-1-methoxybutyl]phenyl]iodanium |
|---|---|
| PubChem CID | 163720504 |
| Molecular Formula | C19H23INO3+ |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [2-[(1S,2S)-2-(benzylcarbamoyloxy)-1-methoxybutyl]phenyl]iodanium |
| SMILES | CC[C@H](OC(=O)NCc1ccccc1)[C@@H](OC)c1ccccc1[IH+] |
| InChI | InChI=1S/C19H22INO3/c1-3-17(18(23-2)15-11-7-8-12-16(15)20)24-19(22)21-13-14-9-5-4-6-10-14/h4-12,17-18,20H,3,13H2,1-2H3/p+1/t17-,18-/m0/s1 |
| InChIKey | KRDCYOBBZOQPFW-ROUUACIJSA-O |
| XLogP | 0.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|