C21H27NO3 — CID 123940919
[1-methoxy-3-methyl-1-(2-methylphenyl)butan-2-yl] N-benzylcarbamate (PubChem CID 123940919) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is [1-methoxy-3-methyl-1-(2-methylphenyl)butan-2-yl] N-benzylcarbamate.
| Compound Name | [1-methoxy-3-methyl-1-(2-methylphenyl)butan-2-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 123940919 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [1-methoxy-3-methyl-1-(2-methylphenyl)butan-2-yl] N-benzylcarbamate |
| SMILES | COC(c1ccccc1C)C(OC(=O)NCc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H27NO3/c1-15(2)19(20(24-4)18-13-9-8-10-16(18)3)25-21(23)22-14-17-11-6-5-7-12-17/h5-13,15,19-20H,14H2,1-4H3,(H,22,23) |
| InChIKey | RNVPAZVHZVUNQD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |