C12H15NS — CID 163724687
5-ethyl-2,5-dimethylthieno[2,3-b]azepine (PubChem CID 163724687) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 5-ethyl-2,5-dimethylthieno[2,3-b]azepine.
| Compound Name | 5-ethyl-2,5-dimethylthieno[2,3-b]azepine |
|---|---|
| PubChem CID | 163724687 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-ethyl-2,5-dimethylthieno[2,3-b]azepine |
| SMILES | CCC1(C)C=CN=c2sc(C)cc2=C1 |
| InChI | InChI=1S/C12H15NS/c1-4-12(3)5-6-13-11-10(8-12)7-9(2)14-11/h5-8H,4H2,1-3H3 |
| InChIKey | KUOSKISDUGTZGX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |