C14H15N3O2S — CID 163727148
5,6-dimethyl-1-pyridin-3-ylsulfonyl-5,6-dihydrobenzimidazole (PubChem CID 163727148) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 5,6-dimethyl-1-pyridin-3-ylsulfonyl-5,6-dihydrobenzimidazole.
| Compound Name | 5,6-dimethyl-1-pyridin-3-ylsulfonyl-5,6-dihydrobenzimidazole |
|---|---|
| PubChem CID | 163727148 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5,6-dimethyl-1-pyridin-3-ylsulfonyl-5,6-dihydrobenzimidazole |
| SMILES | CC1C=c2ncn(S(=O)(=O)c3cccnc3)c2=CC1C |
| InChI | InChI=1S/C14H15N3O2S/c1-10-6-13-14(7-11(10)2)17(9-16-13)20(18,19)12-4-3-5-15-8-12/h3-11H,1-2H3 |
| InChIKey | KWOLEXCQTHNZAC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |