C36H67N7O7S — CID 163727346
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]propanoyl]amino]heptanoyl]amino]heptanoyl]amino]heptanoyl]amino]heptanamide (PubChem CID 163727346) has the molecular formula C36H67N7O7S and a molecular weight of 742.04 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]propanoyl]amino]heptanoyl]amino]heptanoyl]amino]heptanoyl]amino]heptanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]propanoyl]amino]heptanoyl]amino]heptanoyl]amino]heptanoyl]amino]heptanamide |
|---|---|
| PubChem CID | 163727346 |
| Molecular Formula | C36H67N7O7S |
| Molecular Weight | 742.04 g/mol |
| Exact Mass | 741.48 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2R)-2-acetamido-3-sulfanylpropanoyl]amino]propanoyl]amino]heptanoyl]amino]heptanoyl]amino]heptanoyl]amino]heptanamide |
| SMILES | CCCCC[C@H](NC(=O)[C@H](CCCCC)NC(=O)[C@H](CCCCC)NC(=O)[C@H](CCCCC)NC(=O)[C@H](C)NC(=O)[C@H](CS)NC(C)=O)C(N)=O |
| InChI | InChI=1S/C36H67N7O7S/c1-7-11-15-19-26(31(37)45)40-33(47)28(21-17-13-9-3)42-35(49)29(22-18-14-10-4)43-34(48)27(20-16-12-8-2)41-32(46)24(5)38-36(50)30(23-51)39-25(6)44/h24,26-30,51H,7-23H2,1-6H3,(H2,37,45)(H,38,50)(H,39,44)(H,40,47)(H,41,46)(H,42,49)(H,43,48)/t24-,26-,27-,28-,29-,30-/m0/s1 |
| InChIKey | KWSQYIQXVQFMQC-POPCVQDUSA-N |
| XLogP | 2.67 |
| TPSA | 217.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.04 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|