About [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate
[[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate (PubChem CID 163731895) has the molecular formula C19H22N2O7
and a molecular weight of 390.39 g/mol. Its IUPAC name is [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate.
Molecular Properties
| Compound Name | [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate |
| PubChem CID | 163731895 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate |
| SMILES | CN(OC(=O)C1CCC#CCCC1)C(=O)CCCC(=O)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H22N2O7/c1-20(28-19(26)14-8-5-3-2-4-6-9-14)15(22)10-7-11-18(25)27-21-16(23)12-13-17(21)24/h12-14H,3,5-11H2,1H3 |
| InChIKey | LAGSRULXIXTKBV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate?
The IUPAC name of [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate (CID 163731895) is [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate.
What is the SMILES notation for [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate?
The canonical SMILES for [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate is CN(OC(=O)C1CCC#CCCC1)C(=O)CCCC(=O)ON1C(=O)C=CC1=O.
What is the InChIKey of [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate?
The InChIKey is LAGSRULXIXTKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O7/c1-20(28-19(26)14-8-5-3-2-4-6-9-14)15(22)10-7-11-18(25)27-21-16(23)12-13-17(21)24/h12-14H,3,5-11H2,1H3.
What are the key properties of [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate?
[[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate has a molecular weight of 390.39 g/mol, XLogP of 1.04, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] cyclooct-4-yne-1-carboxylate is sourced from PubChem (CID 163731895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).