C19H24N2O7 — CID 163425031
[[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] (4Z)-cyclooct-4-ene-1-carboxylate (PubChem CID 163425031) has the molecular formula C19H24N2O7 and a molecular weight of 392.41 g/mol. Its IUPAC name is [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] (4Z)-cyclooct-4-ene-1-carboxylate.
| Compound Name | [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] (4Z)-cyclooct-4-ene-1-carboxylate |
|---|---|
| PubChem CID | 163425031 |
| Molecular Formula | C19H24N2O7 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino] (4Z)-cyclooct-4-ene-1-carboxylate |
| SMILES | CN(OC(=O)C1CC/C=C\CCC1)C(=O)CCCC(=O)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H24N2O7/c1-20(28-19(26)14-8-5-3-2-4-6-9-14)15(22)10-7-11-18(25)27-21-16(23)12-13-17(21)24/h2-3,12-14H,4-11H2,1H3/b3-2- |
| InChIKey | ALSXBPAAPRKJJI-IHWYPQMZSA-N |
| XLogP | 1.59 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|