C19H22N2O6 — CID 166865410
(2,5-dioxopyrrol-1-yl) 5-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethenoxy-methylamino]-5-oxopentanoate (PubChem CID 166865410) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 5-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethenoxy-methylamino]-5-oxopentanoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 5-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethenoxy-methylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 166865410 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 5-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethenoxy-methylamino]-5-oxopentanoate |
| SMILES | C=C(ON(C)C(=O)CCCC(=O)ON1C(=O)C=CC1=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C19H22N2O6/c1-12(15-11-13-6-7-14(15)10-13)26-20(2)16(22)4-3-5-19(25)27-21-17(23)8-9-18(21)24/h6-9,13-15H,1,3-5,10-11H2,2H3 |
| InChIKey | BJYOOJGYHQVSIH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|