C18H22N2O7 — CID 155120329
[[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]-methylamino] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 155120329) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is [[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]-methylamino] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]-methylamino] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 155120329 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]-methylamino] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CN(OC(=O)C1CC2C=CC1C2)C(=O)CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H22N2O7/c1-19(27-18(25)13-10-11-5-6-12(13)9-11)14(21)3-2-4-17(24)26-20-15(22)7-8-16(20)23/h5-6,11-13H,2-4,7-10H2,1H3 |
| InChIKey | YYRYYKNEFHWQGZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|