C15H21FO6 — CID 163733033
[2,2-dimethyl-5-(oxiran-2-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-fluoro-2-methylpent-4-enoate (PubChem CID 163733033) has the molecular formula C15H21FO6 and a molecular weight of 316.33 g/mol. Its IUPAC name is [2,2-dimethyl-5-(oxiran-2-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-fluoro-2-methylpent-4-enoate.
| Compound Name | [2,2-dimethyl-5-(oxiran-2-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-fluoro-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 163733033 |
| Molecular Formula | C15H21FO6 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | [2,2-dimethyl-5-(oxiran-2-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 2-fluoro-2-methylpent-4-enoate |
| SMILES | C=CCC(C)(F)C(=O)OC1C(C2CO2)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C15H21FO6/c1-5-6-15(4,16)13(17)20-10-9(8-7-18-8)19-12-11(10)21-14(2,3)22-12/h5,8-12H,1,6-7H2,2-4H3 |
| InChIKey | LBFXPJZEQUFARM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|