C18H26O7 — CID 135014471
[(3aR,4S,6R,6aR)-2,2-dimethyl-4-pent-4-enoyloxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pent-4-enoate (PubChem CID 135014471) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-2,2-dimethyl-4-pent-4-enoyloxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pent-4-enoate.
| Compound Name | [(3aR,4S,6R,6aR)-2,2-dimethyl-4-pent-4-enoyloxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pent-4-enoate |
|---|---|
| PubChem CID | 135014471 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(3aR,4S,6R,6aR)-2,2-dimethyl-4-pent-4-enoyloxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pent-4-enoate |
| SMILES | C=CCCC(=O)OC[C@H]1O[C@@H](OC(=O)CCC=C)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H26O7/c1-5-7-9-13(19)21-11-12-15-16(25-18(3,4)24-15)17(22-12)23-14(20)10-8-6-2/h5-6,12,15-17H,1-2,7-11H2,3-4H3/t12-,15-,16-,17+/m1/s1 |
| InChIKey | PVZPKFCSXLAJHK-YYQUZTFQSA-N |
| XLogP | 2.25 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|