C22H34O8 — CID 135015069
[1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pent-4-enoyloxyethyl] pent-4-enoate (PubChem CID 135015069) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is [1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pent-4-enoyloxyethyl] pent-4-enoate.
| Compound Name | [1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pent-4-enoyloxyethyl] pent-4-enoate |
|---|---|
| PubChem CID | 135015069 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | [1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-pent-4-enoyloxyethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC(C1COC(C)(C)O1)C(OC(=O)CCC=C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C22H34O8/c1-7-9-11-17(23)27-19(15-13-25-21(3,4)29-15)20(28-18(24)12-10-8-2)16-14-26-22(5,6)30-16/h7-8,15-16,19-20H,1-2,9-14H2,3-6H3 |
| InChIKey | STYKBCMGYALEKW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|