C17H28O7 — CID 135015070
[1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyethyl] pent-4-enoate (PubChem CID 135015070) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is [1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyethyl] pent-4-enoate.
| Compound Name | [1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyethyl] pent-4-enoate |
|---|---|
| PubChem CID | 135015070 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [1,2-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyethyl] pent-4-enoate |
| SMILES | C=CCCC(=O)OC(C1COC(C)(C)O1)C(O)C1COC(C)(C)O1 |
| InChI | InChI=1S/C17H28O7/c1-6-7-8-13(18)22-15(12-10-21-17(4,5)24-12)14(19)11-9-20-16(2,3)23-11/h6,11-12,14-15,19H,1,7-10H2,2-5H3 |
| InChIKey | CCGNHGRSEAJKMV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|