C50H70O6 — CID 123755408
[(3R,6S)-6-docosa-4,7,10,13,16,19-hexaenoyloxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-3-yl] docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 123755408) has the molecular formula C50H70O6 and a molecular weight of 767.10 g/mol. Its IUPAC name is [(3R,6S)-6-docosa-4,7,10,13,16,19-hexaenoyloxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-3-yl] docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(3R,6S)-6-docosa-4,7,10,13,16,19-hexaenoyloxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-3-yl] docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 123755408 |
| Molecular Formula | C50H70O6 |
| Molecular Weight | 767.10 g/mol |
| Exact Mass | 766.52 |
| IUPAC Name | [(3R,6S)-6-docosa-4,7,10,13,16,19-hexaenoyloxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-3-yl] docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)O[C@@H]1OCC2C1OC[C@@H]2OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C50H70O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-47(51)55-46-44-53-49-45(46)43-54-50(49)56-48(52)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,23-26,29-32,35-38,45-46,49-50H,3-4,9-10,15-16,21-22,27-28,33-34,39-44H2,1-2H3/t45?,46-,49?,50-/m0/s1 |
| InChIKey | NLGCATVUJHPLEY-LVNJHYJFSA-N |
| XLogP | 12.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.10 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|