C27H26N2O3 — CID 163735487
2-[[4-[2-methyl-4-(2-methylphenyl)anilino]phenyl]carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 163735487) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[[4-[2-methyl-4-(2-methylphenyl)anilino]phenyl]carbamoyl]cyclopentene-1-carboxylic acid.
| Compound Name | 2-[[4-[2-methyl-4-(2-methylphenyl)anilino]phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 163735487 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-[[4-[2-methyl-4-(2-methylphenyl)anilino]phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
| SMILES | Cc1cc(-c2ccccc2C)ccc1Nc1ccc(NC(=O)C2=C(C(=O)O)CCC2)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-17-6-3-4-7-22(17)19-10-15-25(18(2)16-19)28-20-11-13-21(14-12-20)29-26(30)23-8-5-9-24(23)27(31)32/h3-4,6-7,10-16,28H,5,8-9H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | LDFJQRMLFBDWNK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |