C27H28FIN3O2- — CID 163735981
2-[2-[(4aS,5R)-1-(4-fluorophenyl)-5-hydroxy-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-yl]ethyl]-N-methyliodanuidylbenzamide (PubChem CID 163735981) has the molecular formula C27H28FIN3O2- and a molecular weight of 572.44 g/mol. Its IUPAC name is 2-[2-[(4aS,5R)-1-(4-fluorophenyl)-5-hydroxy-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-yl]ethyl]-N-methyliodanuidylbenzamide.
| Compound Name | 2-[2-[(4aS,5R)-1-(4-fluorophenyl)-5-hydroxy-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-yl]ethyl]-N-methyliodanuidylbenzamide |
|---|---|
| PubChem CID | 163735981 |
| Molecular Formula | C27H28FIN3O2- |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 2-[2-[(4aS,5R)-1-(4-fluorophenyl)-5-hydroxy-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-yl]ethyl]-N-methyliodanuidylbenzamide |
| SMILES | C[I-]NC(=O)c1ccccc1CC[C@]1(O)CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C27H28FIN3O2/c1-26-16-19-17-30-32(22-9-7-21(28)8-10-22)24(19)15-20(26)12-14-27(26,34)13-11-18-5-3-4-6-23(18)25(33)31-29-2/h3-10,15,17,34H,11-14,16H2,1-2H3,(H,31,33)/q-1/t26-,27-/m0/s1 |
| InChIKey | MPASMDSTMDKHEM-SVBPBHIXSA-N |
| XLogP | 1.48 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|