C26H24FN3O — CID 59612819
(4aS,5R)-1-(4-fluorophenyl)-5-[2-(2-isocyanophenyl)ethyl]-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ol (PubChem CID 59612819) has the molecular formula C26H24FN3O and a molecular weight of 413.50 g/mol. Its IUPAC name is (4aS,5R)-1-(4-fluorophenyl)-5-[2-(2-isocyanophenyl)ethyl]-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ol.
| Compound Name | (4aS,5R)-1-(4-fluorophenyl)-5-[2-(2-isocyanophenyl)ethyl]-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ol |
|---|---|
| PubChem CID | 59612819 |
| Molecular Formula | C26H24FN3O |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (4aS,5R)-1-(4-fluorophenyl)-5-[2-(2-isocyanophenyl)ethyl]-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ol |
| SMILES | [C-]#[N+]c1ccccc1CC[C@]1(O)CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C26H24FN3O/c1-25-16-19-17-29-30(22-9-7-21(27)8-10-22)24(19)15-20(25)12-14-26(25,31)13-11-18-5-3-4-6-23(18)28-2/h3-10,15,17,31H,11-14,16H2,1H3/t25-,26-/m0/s1 |
| InChIKey | ICEWKBMDUKVKQQ-UIOOFZCWSA-N |
| XLogP | 5.67 |
| TPSA | 42.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|