C6H7Cl2N — CID 163736721
N-[(1E,3Z)-1,5-dichloropenta-1,3-dienyl]methanimine (PubChem CID 163736721) has the molecular formula C6H7Cl2N and a molecular weight of 164.03 g/mol. Its IUPAC name is N-[(1E,3Z)-1,5-dichloropenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-1,5-dichloropenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 163736721 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | N-[(1E,3Z)-1,5-dichloropenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(Cl)=C\C=C/CCl |
| InChI | InChI=1S/C6H7Cl2N/c1-9-6(8)4-2-3-5-7/h2-4H,1,5H2/b3-2-,6-4- |
| InChIKey | LEGBUBZTNNRYAX-BXAWZMCCSA-N |
| XLogP | 2.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|