C7H8ClN — CID 143671889
N-[(1E,3Z)-1-chlorohexa-1,3,5-trien-3-yl]methanimine (PubChem CID 143671889) has the molecular formula C7H8ClN and a molecular weight of 141.60 g/mol. Its IUPAC name is N-[(1E,3Z)-1-chlorohexa-1,3,5-trien-3-yl]methanimine.
| Compound Name | N-[(1E,3Z)-1-chlorohexa-1,3,5-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 143671889 |
| Molecular Formula | C7H8ClN |
| Molecular Weight | 141.60 g/mol |
| Exact Mass | 141.03 |
| IUPAC Name | N-[(1E,3Z)-1-chlorohexa-1,3,5-trien-3-yl]methanimine |
| SMILES | C=C/C=C(/C=C/Cl)N=C |
| InChI | InChI=1S/C7H8ClN/c1-3-4-7(9-2)5-6-8/h3-6H,1-2H2/b6-5+,7-4- |
| InChIKey | WNZNBBMUTWMUBJ-NRVNPBJCSA-N |
| XLogP | 2.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|