C7H10ClN — CID 123399701
N-(5-chlorohexa-2,4-dien-2-yl)methanimine (PubChem CID 123399701) has the molecular formula C7H10ClN and a molecular weight of 143.62 g/mol. Its IUPAC name is N-(5-chlorohexa-2,4-dien-2-yl)methanimine.
| Compound Name | N-(5-chlorohexa-2,4-dien-2-yl)methanimine |
|---|---|
| PubChem CID | 123399701 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | N-(5-chlorohexa-2,4-dien-2-yl)methanimine |
| SMILES | C=NC(C)=CC=C(C)Cl |
| InChI | InChI=1S/C7H10ClN/c1-6(8)4-5-7(2)9-3/h4-5H,3H2,1-2H3 |
| InChIKey | RLCHXSQVRHKGAA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|